C33H56O3 — CID 91392163
[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] butanoate (PubChem CID 91392163) has the molecular formula C33H56O3 and a molecular weight of 500.81 g/mol. Its IUPAC name is [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] butanoate.
| Compound Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] butanoate |
|---|---|
| PubChem CID | 91392163 |
| Molecular Formula | C33H56O3 |
| Molecular Weight | 500.81 g/mol |
| Exact Mass | 500.42 |
| IUPAC Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] butanoate |
| SMILES | CCCC(=O)Oc1c(C)c(C)c2c(c1C)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C33H56O3/c1-10-14-30(34)35-31-26(6)27(7)32-29(28(31)8)20-22-33(9,36-32)21-13-19-25(5)18-12-17-24(4)16-11-15-23(2)3/h23-25H,10-22H2,1-9H3/t24-,25-,33-/m1/s1 |
| InChIKey | DSGCIQINMIEXST-WTBTXGFSSA-N |
| XLogP | 9.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.81 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|