C37H63NO5 — CID 175621198
[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 5-(aminomethoxy)-5-methyl-4-oxohexanoate (PubChem CID 175621198) has the molecular formula C37H63NO5 and a molecular weight of 601.91 g/mol. Its IUPAC name is [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 5-(aminomethoxy)-5-methyl-4-oxohexanoate.
| Compound Name | [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 5-(aminomethoxy)-5-methyl-4-oxohexanoate |
|---|---|
| PubChem CID | 175621198 |
| Molecular Formula | C37H63NO5 |
| Molecular Weight | 601.91 g/mol |
| Exact Mass | 601.47 |
| IUPAC Name | [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 5-(aminomethoxy)-5-methyl-4-oxohexanoate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)CCC(=O)C(C)(C)OCN)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C37H63NO5/c1-25(2)14-11-15-26(3)16-12-17-27(4)18-13-22-37(10)23-21-31-30(7)34(28(5)29(6)35(31)43-37)42-33(40)20-19-32(39)36(8,9)41-24-38/h25-27H,11-24,38H2,1-10H3 |
| InChIKey | JPCFKZQKYLFBLU-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.91 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|