C35H57NO6 — CID 155629610
4-oxo-4-[[2-oxo-2-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxy]ethyl]amino]butanoic acid (PubChem CID 155629610) has the molecular formula C35H57NO6 and a molecular weight of 587.84 g/mol. Its IUPAC name is 4-oxo-4-[[2-oxo-2-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxy]ethyl]amino]butanoic acid.
| Compound Name | 4-oxo-4-[[2-oxo-2-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxy]ethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 155629610 |
| Molecular Formula | C35H57NO6 |
| Molecular Weight | 587.84 g/mol |
| Exact Mass | 587.42 |
| IUPAC Name | 4-oxo-4-[[2-oxo-2-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxy]ethyl]amino]butanoic acid |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)CNC(=O)CCC(=O)O)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C35H57NO6/c1-23(2)12-9-13-24(3)14-10-15-25(4)16-11-20-35(8)21-19-29-28(7)33(26(5)27(6)34(29)42-35)41-32(40)22-36-30(37)17-18-31(38)39/h23-25H,9-22H2,1-8H3,(H,36,37)(H,38,39) |
| InChIKey | VTLCITINESOBAU-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.84 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|