C40H67NO6 — CID 155223455
[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[[2-hydroxy-3-(2-methylbutan-2-yloxy)cyclopropanecarbonyl]amino]acetate (PubChem CID 155223455) has the molecular formula C40H67NO6 and a molecular weight of 657.98 g/mol. Its IUPAC name is [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[[2-hydroxy-3-(2-methylbutan-2-yloxy)cyclopropanecarbonyl]amino]acetate.
| Compound Name | [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[[2-hydroxy-3-(2-methylbutan-2-yloxy)cyclopropanecarbonyl]amino]acetate |
|---|---|
| PubChem CID | 155223455 |
| Molecular Formula | C40H67NO6 |
| Molecular Weight | 657.98 g/mol |
| Exact Mass | 657.50 |
| IUPAC Name | [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[[2-hydroxy-3-(2-methylbutan-2-yloxy)cyclopropanecarbonyl]amino]acetate |
| SMILES | CCC(C)(C)OC1C(O)C1C(=O)NCC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C40H67NO6/c1-12-39(9,10)46-37-33(34(37)43)38(44)41-24-32(42)45-35-28(6)29(7)36-31(30(35)8)21-23-40(11,47-36)22-15-20-27(5)19-14-18-26(4)17-13-16-25(2)3/h25-27,33-34,37,43H,12-24H2,1-11H3,(H,41,44) |
| InChIKey | BZUWRYLBFZBOHO-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.98 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|