C41H72O5 — CID 155713390
ethane;1-O-methyl 5-O-[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2,2,4,4-tetramethylpentanedioate (PubChem CID 155713390) has the molecular formula C41H72O5 and a molecular weight of 645.02 g/mol. Its IUPAC name is ethane;1-O-methyl 5-O-[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2,2,4,4-tetramethylpentanedioate.
| Compound Name | ethane;1-O-methyl 5-O-[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2,2,4,4-tetramethylpentanedioate |
|---|---|
| PubChem CID | 155713390 |
| Molecular Formula | C41H72O5 |
| Molecular Weight | 645.02 g/mol |
| Exact Mass | 644.54 |
| IUPAC Name | ethane;1-O-methyl 5-O-[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2,2,4,4-tetramethylpentanedioate |
| SMILES | CC.COC(=O)C(C)(C)CC(C)(C)C(=O)Oc1c(C)c(C)c2c(c1C)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C39H66O5.C2H6/c1-26(2)17-14-18-27(3)19-15-20-28(4)21-16-23-39(12)24-22-32-31(7)33(29(5)30(6)34(32)44-39)43-36(41)38(10,11)25-37(8,9)35(40)42-13;1-2/h26-28H,14-25H2,1-13H3;1-2H3/t27-,28-,39-;/m1./s1 |
| InChIKey | RBNIFTACGAGPGX-DHYYMQMOSA-N |
| XLogP | 11.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.02 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|