C32H55NO3S — CID 10143366
[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-amino-3-sulfanylpropanoate (PubChem CID 10143366) has the molecular formula C32H55NO3S and a molecular weight of 533.86 g/mol. Its IUPAC name is [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-amino-3-sulfanylpropanoate.
| Compound Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 10143366 |
| Molecular Formula | C32H55NO3S |
| Molecular Weight | 533.86 g/mol |
| Exact Mass | 533.39 |
| IUPAC Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-amino-3-sulfanylpropanoate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)C(N)CS)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C32H55NO3S/c1-21(2)12-9-13-22(3)14-10-15-23(4)16-11-18-32(8)19-17-27-26(7)29(35-31(34)28(33)20-37)24(5)25(6)30(27)36-32/h21-23,28,37H,9-20,33H2,1-8H3/t22-,23-,28?,32-/m1/s1 |
| InChIKey | NUBDGXISDCZTNF-INLWXIBTSA-N |
| XLogP | 8.30 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.86 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|