C34H61O3P — CID 155713441
phosphane;[(2R)-2,5,7,8-tetramethyl-2-[(4S,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-methylbutanoate (PubChem CID 155713441) has the molecular formula C34H61O3P and a molecular weight of 548.83 g/mol. Its IUPAC name is phosphane;[(2R)-2,5,7,8-tetramethyl-2-[(4S,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-methylbutanoate.
| Compound Name | phosphane;[(2R)-2,5,7,8-tetramethyl-2-[(4S,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 155713441 |
| Molecular Formula | C34H61O3P |
| Molecular Weight | 548.83 g/mol |
| Exact Mass | 548.44 |
| IUPAC Name | phosphane;[(2R)-2,5,7,8-tetramethyl-2-[(4S,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1c(C)c(C)c2c(c1C)CC[C@@](C)(CCC[C@@H](C)CCC[C@H](C)CCCC(C)C)O2.P |
| InChI | InChI=1S/C34H58O3.H3P/c1-11-26(6)33(35)36-31-27(7)28(8)32-30(29(31)9)20-22-34(10,37-32)21-14-19-25(5)18-13-17-24(4)16-12-15-23(2)3;/h23-26H,11-22H2,1-10H3;1H3/t24-,25+,26?,34-;/m1./s1 |
| InChIKey | SFDUTWZCYQKPFZ-FIJHAPNXSA-N |
| XLogP | 10.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.83 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|