C33H57NO3 — CID 11376297
[(2S)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-(dimethylamino)acetate (PubChem CID 11376297) has the molecular formula C33H57NO3 and a molecular weight of 515.82 g/mol. Its IUPAC name is [(2S)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-(dimethylamino)acetate.
| Compound Name | [(2S)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 11376297 |
| Molecular Formula | C33H57NO3 |
| Molecular Weight | 515.82 g/mol |
| Exact Mass | 515.43 |
| IUPAC Name | [(2S)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 2-(dimethylamino)acetate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)CN(C)C)CC[C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C33H57NO3/c1-23(2)14-11-15-24(3)16-12-17-25(4)18-13-20-33(8)21-19-29-28(7)31(36-30(35)22-34(9)10)26(5)27(6)32(29)37-33/h23-25H,11-22H2,1-10H3/t24-,25-,33+/m1/s1 |
| InChIKey | JHWHRMSIWNAOQI-PHLCOOFXSA-N |
| XLogP | 8.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.82 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|