C32H55NO3 — CID 11605771
[2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-(dimethylamino)acetate (PubChem CID 11605771) has the molecular formula C32H55NO3 and a molecular weight of 501.80 g/mol. Its IUPAC name is [2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-(dimethylamino)acetate.
| Compound Name | [2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 11605771 |
| Molecular Formula | C32H55NO3 |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.42 |
| IUPAC Name | [2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-(dimethylamino)acetate |
| SMILES | Cc1c(OC(=O)CN(C)C)cc2c(c1C)OC(C)(CCCC(C)CCCC(C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C32H55NO3/c1-23(2)13-10-14-24(3)15-11-16-25(4)17-12-19-32(7)20-18-28-21-29(35-30(34)22-33(8)9)26(5)27(6)31(28)36-32/h21,23-25H,10-20,22H2,1-9H3 |
| InChIKey | MHCXNWZWKJZVPR-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|