C28H51O6P — CID 174558710
phosphoric acid;(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol (PubChem CID 174558710) has the molecular formula C28H51O6P and a molecular weight of 514.68 g/mol. Its IUPAC name is phosphoric acid;(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol.
| Compound Name | phosphoric acid;(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 174558710 |
| Molecular Formula | C28H51O6P |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.34 |
| IUPAC Name | phosphoric acid;(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(O)cc2c(c1C)O[C@](C)(CCCC(C)CCCC(C)CCCC(C)C)CC2.O=P(O)(O)O |
| InChI | InChI=1S/C28H48O2.H3O4P/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28;1-5(2,3)4/h19-22,29H,8-18H2,1-7H3;(H3,1,2,3,4)/t21?,22?,28-;/m1./s1 |
| InChIKey | IEJJEMHJIRHKCV-WSULYREUSA-N |
| XLogP | 7.60 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|