C17H28BrO2P — CID 23197366
2-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)ethyl-trimethylphosphanium bromide (PubChem CID 23197366) has the molecular formula C17H28BrO2P and a molecular weight of 375.29 g/mol. Its IUPAC name is 2-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)ethyl-trimethylphosphanium bromide.
| Compound Name | 2-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)ethyl-trimethylphosphanium bromide |
|---|---|
| PubChem CID | 23197366 |
| Molecular Formula | C17H28BrO2P |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)ethyl-trimethylphosphanium bromide |
| SMILES | Cc1c(O)cc2c(c1C)OC(C)(CC[P+](C)(C)C)CC2.[Br-] |
| InChI | InChI=1S/C17H27O2P.BrH/c1-12-13(2)16-14(11-15(12)18)7-8-17(3,19-16)9-10-20(4,5)6;/h11H,7-10H2,1-6H3;1H |
| InChIKey | UCEBOZBHGJKPEC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|