C33H60O2 — CID 155713412
ethane;prop-1-ene;2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol (PubChem CID 155713412) has the molecular formula C33H60O2 and a molecular weight of 488.84 g/mol. Its IUPAC name is ethane;prop-1-ene;2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol.
| Compound Name | ethane;prop-1-ene;2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 155713412 |
| Molecular Formula | C33H60O2 |
| Molecular Weight | 488.84 g/mol |
| Exact Mass | 488.46 |
| IUPAC Name | ethane;prop-1-ene;2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
| SMILES | C=CC.CC.Cc1c(O)cc2c(c1C)OC(C)(CCCC(C)CCCC(C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C28H48O2.C3H6.C2H6/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28;1-3-2;1-2/h19-22,29H,8-18H2,1-7H3;3H,1H2,2H3;1-2H3 |
| InChIKey | SZUNPNHSLNJKST-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.84 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|