C31H54O2 — CID 123549807
2,5,7,8-tetramethyl-2-(5,10,14-trimethylpentadecyl)-3,4-dihydrochromen-6-ol (PubChem CID 123549807) has the molecular formula C31H54O2 and a molecular weight of 458.77 g/mol. Its IUPAC name is 2,5,7,8-tetramethyl-2-(5,10,14-trimethylpentadecyl)-3,4-dihydrochromen-6-ol.
| Compound Name | 2,5,7,8-tetramethyl-2-(5,10,14-trimethylpentadecyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 123549807 |
| Molecular Formula | C31H54O2 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.41 |
| IUPAC Name | 2,5,7,8-tetramethyl-2-(5,10,14-trimethylpentadecyl)-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCCCC(C)CCCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C31H54O2/c1-22(2)14-13-18-24(4)16-10-9-15-23(3)17-11-12-20-31(8)21-19-28-27(7)29(32)25(5)26(6)30(28)33-31/h22-24,32H,9-21H2,1-8H3 |
| InChIKey | HZWBFWVJBLSNDS-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|