C39H68O6 — CID 66664845
decanedioic acid;(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol (PubChem CID 66664845) has the molecular formula C39H68O6 and a molecular weight of 632.97 g/mol. Its IUPAC name is decanedioic acid;(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol.
| Compound Name | decanedioic acid;(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 66664845 |
| Molecular Formula | C39H68O6 |
| Molecular Weight | 632.97 g/mol |
| Exact Mass | 632.50 |
| IUPAC Name | decanedioic acid;(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C29H50O2.C10H18O4/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29;11-9(12)7-5-3-1-2-4-6-8-10(13)14/h20-22,30H,9-19H2,1-8H3;1-8H2,(H,11,12)(H,13,14)/t21-,22-,29-;/m1./s1 |
| InChIKey | NYOZGTJWZVUJAC-WTCAIEHQSA-N |
| XLogP | 11.12 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.97 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|