C38H67ClO6 — CID 174769298
butanedioic acid;1-chloropentane;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol (PubChem CID 174769298) has the molecular formula C38H67ClO6 and a molecular weight of 655.40 g/mol. Its IUPAC name is butanedioic acid;1-chloropentane;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol.
| Compound Name | butanedioic acid;1-chloropentane;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 174769298 |
| Molecular Formula | C38H67ClO6 |
| Molecular Weight | 655.40 g/mol |
| Exact Mass | 654.46 |
| IUPAC Name | butanedioic acid;1-chloropentane;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
| SMILES | CCCCCCl.Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(CCCC(C)CCCC(C)CCCC(C)C)O2.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C29H50O2.C5H11Cl.C4H6O4/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29;1-2-3-4-5-6;5-3(6)1-2-4(7)8/h20-22,30H,9-19H2,1-8H3;2-5H2,1H3;1-2H2,(H,5,6)(H,7,8)/t21?,22?,29-;;/m1../s1 |
| InChIKey | WTDFPFSPNZWWOI-PCRDKLNYSA-N |
| XLogP | 11.19 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.40 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|