C29H52O6S — CID 175105897
sulfuric acid;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol (PubChem CID 175105897) has the molecular formula C29H52O6S and a molecular weight of 528.80 g/mol. Its IUPAC name is sulfuric acid;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol.
| Compound Name | sulfuric acid;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 175105897 |
| Molecular Formula | C29H52O6S |
| Molecular Weight | 528.80 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | sulfuric acid;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(CCCC(C)CCCC(C)CCCC(C)C)O2.O=S(=O)(O)O |
| InChI | InChI=1S/C29H50O2.H2O4S/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29;1-5(2,3)4/h20-22,30H,9-19H2,1-8H3;(H2,1,2,3,4)/t21?,22?,29-;/m1./s1 |
| InChIKey | QDKATGZVZCYPCX-FIICNZCFSA-N |
| XLogP | 8.19 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.80 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|