C29H51ClO2 — CID 141451505
(2S)-2,5,7,8-tetramethyl-2-[(4R,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol;hydrochloride (PubChem CID 141451505) has the molecular formula C29H51ClO2 and a molecular weight of 467.18 g/mol. Its IUPAC name is (2S)-2,5,7,8-tetramethyl-2-[(4R,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol;hydrochloride.
| Compound Name | (2S)-2,5,7,8-tetramethyl-2-[(4R,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol;hydrochloride |
|---|---|
| PubChem CID | 141451505 |
| Molecular Formula | C29H51ClO2 |
| Molecular Weight | 467.18 g/mol |
| Exact Mass | 466.36 |
| IUPAC Name | (2S)-2,5,7,8-tetramethyl-2-[(4R,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol;hydrochloride |
| SMILES | Cc1c(C)c2c(c(C)c1O)CC[C@](C)(CCC[C@H](C)CCC[C@@H](C)CCCC(C)C)O2.Cl |
| InChI | InChI=1S/C29H50O2.ClH/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29;/h20-22,30H,9-19H2,1-8H3;1H/t21-,22+,29-;/m0./s1 |
| InChIKey | YWIGDNYQEOWTAH-LITZLKRQSA-N |
| XLogP | 9.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.18 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |