C27H47O5P — CID 11600375
[2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] dihydrogen phosphate (PubChem CID 11600375) has the molecular formula C27H47O5P and a molecular weight of 482.64 g/mol. Its IUPAC name is [2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] dihydrogen phosphate.
| Compound Name | [2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11600375 |
| Molecular Formula | C27H47O5P |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | [2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] dihydrogen phosphate |
| SMILES | Cc1cc(OP(=O)(O)O)cc2c1OC(C)(CCCC(C)CCCC(C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C27H47O5P/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-16-27(6)17-15-24-19-25(32-33(28,29)30)18-23(5)26(24)31-27/h18-22H,7-17H2,1-6H3,(H2,28,29,30) |
| InChIKey | WXZNTTGHRUCCDT-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|