C33H57BO3 — CID 71560701
2-[(2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 71560701) has the molecular formula C33H57BO3 and a molecular weight of 512.63 g/mol. Its IUPAC name is 2-[(2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 71560701 |
| Molecular Formula | C33H57BO3 |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.44 |
| IUPAC Name | 2-[(2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc2c1O[C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C33H57BO3/c1-24(2)14-11-15-25(3)16-12-17-26(4)18-13-20-33(10)21-19-28-23-29(22-27(5)30(28)35-33)34-36-31(6,7)32(8,9)37-34/h22-26H,11-21H2,1-10H3/t25-,26-,33-/m1/s1 |
| InChIKey | NEJWOTFPDISELK-AHYUKCMYSA-N |
| XLogP | 8.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|