C30H48O3 — CID 162861566
[2,8-dimethyl-2-(4,8,11,12-tetramethyltridec-12-enyl)-3,4-dihydrochromen-6-yl] acetate (PubChem CID 162861566) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is [2,8-dimethyl-2-(4,8,11,12-tetramethyltridec-12-enyl)-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2,8-dimethyl-2-(4,8,11,12-tetramethyltridec-12-enyl)-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 162861566 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | [2,8-dimethyl-2-(4,8,11,12-tetramethyltridec-12-enyl)-3,4-dihydrochromen-6-yl] acetate |
| SMILES | C=C(C)C(C)CCC(C)CCCC(C)CCCC1(C)CCc2cc(OC(C)=O)cc(C)c2O1 |
| InChI | InChI=1S/C30H48O3/c1-21(2)24(5)15-14-23(4)12-9-11-22(3)13-10-17-30(8)18-16-27-20-28(32-26(7)31)19-25(6)29(27)33-30/h19-20,22-24H,1,9-18H2,2-8H3 |
| InChIKey | HVHKJKPLMSMAIK-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|