C29H42O4 — CID 24795935
[(2R)-2,8-dimethyl-2-[(3E,8S,10E)-4,8,12-trimethyl-9-oxotrideca-3,10-dienyl]-3,4-dihydrochromen-6-yl] acetate (PubChem CID 24795935) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is [(2R)-2,8-dimethyl-2-[(3E,8S,10E)-4,8,12-trimethyl-9-oxotrideca-3,10-dienyl]-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [(2R)-2,8-dimethyl-2-[(3E,8S,10E)-4,8,12-trimethyl-9-oxotrideca-3,10-dienyl]-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 24795935 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | [(2R)-2,8-dimethyl-2-[(3E,8S,10E)-4,8,12-trimethyl-9-oxotrideca-3,10-dienyl]-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1cc(C)c2c(c1)CC[C@@](C)(CC/C=C(\C)CCC[C@H](C)C(=O)/C=C/C(C)C)O2 |
| InChI | InChI=1S/C29H42O4/c1-20(2)13-14-27(31)22(4)12-8-10-21(3)11-9-16-29(7)17-15-25-19-26(32-24(6)30)18-23(5)28(25)33-29/h11,13-14,18-20,22H,8-10,12,15-17H2,1-7H3/b14-13+,21-11+/t22-,29+/m0/s1 |
| InChIKey | CBQKSRUOKOCESL-NBBVVGMNSA-N |
| XLogP | 7.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|