C32H50O4 — CID 102351634
(4S,10E,14E)-4-hydroxy-17-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-2,6,10,14-tetramethylheptadeca-10,14-dien-5-one (PubChem CID 102351634) has the molecular formula C32H50O4 and a molecular weight of 498.75 g/mol. Its IUPAC name is (4S,10E,14E)-4-hydroxy-17-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-2,6,10,14-tetramethylheptadeca-10,14-dien-5-one.
| Compound Name | (4S,10E,14E)-4-hydroxy-17-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-2,6,10,14-tetramethylheptadeca-10,14-dien-5-one |
|---|---|
| PubChem CID | 102351634 |
| Molecular Formula | C32H50O4 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | (4S,10E,14E)-4-hydroxy-17-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-2,6,10,14-tetramethylheptadeca-10,14-dien-5-one |
| SMILES | C/C(=C\CC[C@]1(C)CCc2cc(O)cc(C)c2O1)CC/C=C(\C)CCCC(C)C(=O)[C@@H](O)CC(C)C |
| InChI | InChI=1S/C32H50O4/c1-22(2)19-29(34)30(35)25(5)15-9-13-23(3)11-8-12-24(4)14-10-17-32(7)18-16-27-21-28(33)20-26(6)31(27)36-32/h11,14,20-22,25,29,33-34H,8-10,12-13,15-19H2,1-7H3/b23-11+,24-14+/t25?,29-,32+/m0/s1 |
| InChIKey | HGXRZMYVLWOAJX-KLLREJPQSA-N |
| XLogP | 8.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|