C32H48O3 — CID 102351627
(2R)-2-[(3E,7E,11E,13R)-13-hydroxy-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-2,8-dimethyl-3,4-dihydrochromen-6-ol (PubChem CID 102351627) has the molecular formula C32H48O3 and a molecular weight of 480.73 g/mol. Its IUPAC name is (2R)-2-[(3E,7E,11E,13R)-13-hydroxy-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-2,8-dimethyl-3,4-dihydrochromen-6-ol.
| Compound Name | (2R)-2-[(3E,7E,11E,13R)-13-hydroxy-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-2,8-dimethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 102351627 |
| Molecular Formula | C32H48O3 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | (2R)-2-[(3E,7E,11E,13R)-13-hydroxy-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-2,8-dimethyl-3,4-dihydrochromen-6-ol |
| SMILES | CC(C)=CC[C@@H](O)/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2cc(O)cc(C)c2O1 |
| InChI | InChI=1S/C32H48O3/c1-23(2)16-17-30(34)26(5)15-9-13-24(3)11-8-12-25(4)14-10-19-32(7)20-18-28-22-29(33)21-27(6)31(28)35-32/h11,14-16,21-22,30,33-34H,8-10,12-13,17-20H2,1-7H3/b24-11+,25-14+,26-15+/t30-,32-/m1/s1 |
| InChIKey | OFUOJNKMLJESTP-PHLGIVGQSA-N |
| XLogP | 8.68 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|