C31H48O6 — CID 24796377
(4R,6S,10E)-4-(methoxymethoxy)-13-[(2R)-6-(methoxymethoxy)-2,8-dimethyl-3,4-dihydrochromen-2-yl]-2,6,10-trimethyltrideca-2,10-dien-5-one (PubChem CID 24796377) has the molecular formula C31H48O6 and a molecular weight of 516.72 g/mol. Its IUPAC name is (4R,6S,10E)-4-(methoxymethoxy)-13-[(2R)-6-(methoxymethoxy)-2,8-dimethyl-3,4-dihydrochromen-2-yl]-2,6,10-trimethyltrideca-2,10-dien-5-one.
| Compound Name | (4R,6S,10E)-4-(methoxymethoxy)-13-[(2R)-6-(methoxymethoxy)-2,8-dimethyl-3,4-dihydrochromen-2-yl]-2,6,10-trimethyltrideca-2,10-dien-5-one |
|---|---|
| PubChem CID | 24796377 |
| Molecular Formula | C31H48O6 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | (4R,6S,10E)-4-(methoxymethoxy)-13-[(2R)-6-(methoxymethoxy)-2,8-dimethyl-3,4-dihydrochromen-2-yl]-2,6,10-trimethyltrideca-2,10-dien-5-one |
| SMILES | COCOc1cc(C)c2c(c1)CC[C@@](C)(CC/C=C(\C)CCC[C@H](C)C(=O)[C@@H](C=C(C)C)OCOC)O2 |
| InChI | InChI=1S/C31H48O6/c1-22(2)17-28(36-21-34-8)29(32)24(4)13-9-11-23(3)12-10-15-31(6)16-14-26-19-27(35-20-33-7)18-25(5)30(26)37-31/h12,17-19,24,28H,9-11,13-16,20-21H2,1-8H3/b23-12+/t24-,28+,31+/m0/s1 |
| InChIKey | QFYWKSOWILFUGV-JHVDWCNTSA-N |
| XLogP | 7.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|