C31H44O7 — CID 164614143
4-[[(2R)-2-[(3E,7E)-13-hydroxy-12-(hydroxymethyl)-4,8-dimethyltrideca-3,7,11-trienyl]-2,8-dimethyl-3,4-dihydrochromen-6-yl]oxy]-4-oxobutanoic acid (PubChem CID 164614143) has the molecular formula C31H44O7 and a molecular weight of 528.69 g/mol. Its IUPAC name is 4-[[(2R)-2-[(3E,7E)-13-hydroxy-12-(hydroxymethyl)-4,8-dimethyltrideca-3,7,11-trienyl]-2,8-dimethyl-3,4-dihydrochromen-6-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(2R)-2-[(3E,7E)-13-hydroxy-12-(hydroxymethyl)-4,8-dimethyltrideca-3,7,11-trienyl]-2,8-dimethyl-3,4-dihydrochromen-6-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 164614143 |
| Molecular Formula | C31H44O7 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 4-[[(2R)-2-[(3E,7E)-13-hydroxy-12-(hydroxymethyl)-4,8-dimethyltrideca-3,7,11-trienyl]-2,8-dimethyl-3,4-dihydrochromen-6-yl]oxy]-4-oxobutanoic acid |
| SMILES | C/C(=C\CC/C(C)=C/CC[C@]1(C)CCc2cc(OC(=O)CCC(=O)O)cc(C)c2O1)CCC=C(CO)CO |
| InChI | InChI=1S/C31H44O7/c1-22(10-6-12-25(20-32)21-33)8-5-9-23(2)11-7-16-31(4)17-15-26-19-27(18-24(3)30(26)38-31)37-29(36)14-13-28(34)35/h8,11-12,18-19,32-33H,5-7,9-10,13-17,20-21H2,1-4H3,(H,34,35)/b22-8+,23-11+/t31-/m1/s1 |
| InChIKey | DVRUOAVGSNCOLY-BZWLWALNSA-N |
| XLogP | 5.99 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|