C14H18O7S — CID 172880023
3-(2,8-dimethyl-6-sulfooxy-3,4-dihydrochromen-2-yl)propanoic acid (PubChem CID 172880023) has the molecular formula C14H18O7S and a molecular weight of 330.36 g/mol. Its IUPAC name is 3-(2,8-dimethyl-6-sulfooxy-3,4-dihydrochromen-2-yl)propanoic acid.
| Compound Name | 3-(2,8-dimethyl-6-sulfooxy-3,4-dihydrochromen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 172880023 |
| Molecular Formula | C14H18O7S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 3-(2,8-dimethyl-6-sulfooxy-3,4-dihydrochromen-2-yl)propanoic acid |
| SMILES | Cc1cc(OS(=O)(=O)O)cc2c1OC(C)(CCC(=O)O)CC2 |
| InChI | InChI=1S/C14H18O7S/c1-9-7-11(21-22(17,18)19)8-10-3-5-14(2,20-13(9)10)6-4-12(15)16/h7-8H,3-6H2,1-2H3,(H,15,16)(H,17,18,19) |
| InChIKey | LUHSNVSFONCQQJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|