C34H49BrO3 — CID 164511032
[(2S)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-bromobenzoate (PubChem CID 164511032) has the molecular formula C34H49BrO3 and a molecular weight of 585.67 g/mol. Its IUPAC name is [(2S)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-bromobenzoate.
| Compound Name | [(2S)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 164511032 |
| Molecular Formula | C34H49BrO3 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | [(2S)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-bromobenzoate |
| SMILES | Cc1cc(OC(=O)c2ccc(Br)cc2)cc2c1O[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C34H49BrO3/c1-24(2)10-7-11-25(3)12-8-13-26(4)14-9-20-34(6)21-19-29-23-31(22-27(5)32(29)38-34)37-33(36)28-15-17-30(35)18-16-28/h15-18,22-26H,7-14,19-21H2,1-6H3/t25-,26-,34+/m1/s1 |
| InChIKey | PZUJKLSRXYFSSV-UVNCRYBCSA-N |
| XLogP | 10.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|