C47H62FNO4 — CID 154709506
[(2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-[3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-2-fluoroprop-1-enyl]benzoate (PubChem CID 154709506) has the molecular formula C47H62FNO4 and a molecular weight of 724.01 g/mol. Its IUPAC name is [(2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-[3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-2-fluoroprop-1-enyl]benzoate.
| Compound Name | [(2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-[3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-2-fluoroprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 154709506 |
| Molecular Formula | C47H62FNO4 |
| Molecular Weight | 724.01 g/mol |
| Exact Mass | 723.47 |
| IUPAC Name | [(2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-[3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-2-fluoroprop-1-enyl]benzoate |
| SMILES | Cc1cc(OC(=O)c2ccc(C=C(F)C[C@@]3(C)C(=O)N(C)c4ccccc43)cc2)cc2c1O[C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C47H62FNO4/c1-32(2)14-11-15-33(3)16-12-17-34(4)18-13-26-46(6)27-25-38-30-40(28-35(5)43(38)53-46)52-44(50)37-23-21-36(22-24-37)29-39(48)31-47(7)41-19-9-10-20-42(41)49(8)45(47)51/h9-10,19-24,28-30,32-34H,11-18,25-27,31H2,1-8H3/t33-,34-,46-,47-/m1/s1 |
| InChIKey | YGTSCZHWDJPULR-HDOROAAYSA-N |
| XLogP | 12.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.01 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|