C41H64O11 — CID 101108771
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2S)-2,8-dimethyl-2-[(4S,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 101108771) has the molecular formula C41H64O11 and a molecular weight of 732.95 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2S)-2,8-dimethyl-2-[(4S,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2S)-2,8-dimethyl-2-[(4S,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101108771 |
| Molecular Formula | C41H64O11 |
| Molecular Weight | 732.95 g/mol |
| Exact Mass | 732.44 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2S)-2,8-dimethyl-2-[(4S,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2cc(C)c3c(c2)CC[C@](C)(CCC[C@@H](C)CCC[C@@H](C)CCCC(C)C)O3)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C41H64O11/c1-25(2)14-11-15-26(3)16-12-17-27(4)18-13-20-41(10)21-19-33-23-34(22-28(5)36(33)52-41)50-40-39(49-32(9)45)38(48-31(8)44)37(47-30(7)43)35(51-40)24-46-29(6)42/h22-23,25-27,35,37-40H,11-21,24H2,1-10H3/t26-,27-,35+,37+,38-,39+,40+,41-/m0/s1 |
| InChIKey | UZKWGSHEZRQNIF-BFEABLTOSA-N |
| XLogP | 7.98 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.95 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|