C24H28O14 — CID 15236161
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3,5-diacetyloxyphenoxy)oxan-2-yl]methyl acetate (PubChem CID 15236161) has the molecular formula C24H28O14 and a molecular weight of 540.47 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3,5-diacetyloxyphenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3,5-diacetyloxyphenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 15236161 |
| Molecular Formula | C24H28O14 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3,5-diacetyloxyphenoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2cc(OC(C)=O)cc(OC(C)=O)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H28O14/c1-11(25)31-10-20-21(34-14(4)28)22(35-15(5)29)23(36-16(6)30)24(38-20)37-19-8-17(32-12(2)26)7-18(9-19)33-13(3)27/h7-9,20-24H,10H2,1-6H3/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | NPYZETSBCZCOAG-GNADVCDUSA-N |
| XLogP | 1.00 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|