C22H25IO12 — CID 11786803
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-acetyloxy-5-iodophenoxy)oxan-2-yl]methyl acetate (PubChem CID 11786803) has the molecular formula C22H25IO12 and a molecular weight of 608.33 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-acetyloxy-5-iodophenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-acetyloxy-5-iodophenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11786803 |
| Molecular Formula | C22H25IO12 |
| Molecular Weight | 608.33 g/mol |
| Exact Mass | 608.04 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-acetyloxy-5-iodophenoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2cc(I)cc(OC(C)=O)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H25IO12/c1-10(24)29-9-18-19(31-12(3)26)20(32-13(4)27)21(33-14(5)28)22(35-18)34-17-7-15(23)6-16(8-17)30-11(2)25/h6-8,18-22H,9H2,1-5H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | XDJWDSLOEPPLAA-QMCAAQAGSA-N |
| XLogP | 1.68 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|