C25H34O10 — CID 59415716
[(3R,4S,6S)-3,5-diacetyloxy-6-(3-acetyloxy-5-methylphenoxy)-4-butyloxan-2-yl]methyl acetate (PubChem CID 59415716) has the molecular formula C25H34O10 and a molecular weight of 494.54 g/mol. Its IUPAC name is [(3R,4S,6S)-3,5-diacetyloxy-6-(3-acetyloxy-5-methylphenoxy)-4-butyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6S)-3,5-diacetyloxy-6-(3-acetyloxy-5-methylphenoxy)-4-butyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59415716 |
| Molecular Formula | C25H34O10 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | [(3R,4S,6S)-3,5-diacetyloxy-6-(3-acetyloxy-5-methylphenoxy)-4-butyloxan-2-yl]methyl acetate |
| SMILES | CCCC[C@@H]1C(OC(C)=O)[C@H](Oc2cc(C)cc(OC(C)=O)c2)OC(COC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H34O10/c1-7-8-9-21-23(32-17(5)28)22(13-30-15(3)26)35-25(24(21)33-18(6)29)34-20-11-14(2)10-19(12-20)31-16(4)27/h10-12,21-25H,7-9,13H2,1-6H3/t21-,22?,23+,24?,25+/m0/s1 |
| InChIKey | VSUWITHXIMLGGF-VEBPXMROSA-N |
| XLogP | 3.26 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|