C29H42O11 — CID 10460584
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-hexoxy-2,3,6-trimethylphenoxy)oxan-2-yl]methyl acetate (PubChem CID 10460584) has the molecular formula C29H42O11 and a molecular weight of 566.64 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-hexoxy-2,3,6-trimethylphenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-hexoxy-2,3,6-trimethylphenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10460584 |
| Molecular Formula | C29H42O11 |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-hexoxy-2,3,6-trimethylphenoxy)oxan-2-yl]methyl acetate |
| SMILES | CCCCCCOc1cc(C)c(O[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c(C)c1C |
| InChI | InChI=1S/C29H42O11/c1-9-10-11-12-13-34-23-14-16(2)25(18(4)17(23)3)40-29-28(38-22(8)33)27(37-21(7)32)26(36-20(6)31)24(39-29)15-35-19(5)30/h14,24,26-29H,9-13,15H2,1-8H3/t24-,26-,27+,28-,29-/m1/s1 |
| InChIKey | CAAJVTUGGADFGG-KRZJEZTLSA-N |
| XLogP | 4.03 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|