C21H34O7 — CID 10046424
(2S,3R,4S,5R,6R)-2-(4-hexoxy-2,3,6-trimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10046424) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-(4-hexoxy-2,3,6-trimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-(4-hexoxy-2,3,6-trimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10046424 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-(4-hexoxy-2,3,6-trimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCOc1cc(C)c(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c(C)c1C |
| InChI | InChI=1S/C21H34O7/c1-5-6-7-8-9-26-15-10-12(2)20(14(4)13(15)3)28-21-19(25)18(24)17(23)16(11-22)27-21/h10,16-19,21-25H,5-9,11H2,1-4H3/t16-,17+,18+,19-,21+/m1/s1 |
| InChIKey | BUNYWFFPZZKCNF-CWVBCOCOSA-N |
| XLogP | 1.75 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|