C25H42O7 — CID 10321753
(2S,3R,4S,5S,6R)-2-(4-decoxy-2,3,6-trimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10321753) has the molecular formula C25H42O7 and a molecular weight of 454.60 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(4-decoxy-2,3,6-trimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(4-decoxy-2,3,6-trimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10321753 |
| Molecular Formula | C25H42O7 |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(4-decoxy-2,3,6-trimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCCCCCOc1cc(C)c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(C)c1C |
| InChI | InChI=1S/C25H42O7/c1-5-6-7-8-9-10-11-12-13-30-19-14-16(2)24(18(4)17(19)3)32-25-23(29)22(28)21(27)20(15-26)31-25/h14,20-23,25-29H,5-13,15H2,1-4H3/t20-,21-,22+,23-,25+/m1/s1 |
| InChIKey | HMBPALAHNRUDLH-ABMICEGHSA-N |
| XLogP | 3.31 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|