C29H30O13 — CID 155262584
[3,4,5-triacetyloxy-6-[[(2Z)-7-methyl-2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-5-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 155262584) has the molecular formula C29H30O13 and a molecular weight of 586.55 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[[(2Z)-7-methyl-2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-5-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[[(2Z)-7-methyl-2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-5-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155262584 |
| Molecular Formula | C29H30O13 |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[[(2Z)-7-methyl-2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-5-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2cc(C)c3c(c2)C(=O)/C(=C/c2ccc(C)o2)O3)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C29H30O13/c1-13-9-20(10-21-24(34)22(41-25(13)21)11-19-8-7-14(2)36-19)40-29-28(39-18(6)33)27(38-17(5)32)26(37-16(4)31)23(42-29)12-35-15(3)30/h7-11,23,26-29H,12H2,1-6H3/b22-11- |
| InChIKey | QLQKRRJBEWVIND-JJFYIABZSA-N |
| XLogP | 2.97 |
| TPSA | 163.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|