C47H72O3 — CID 11169913
[2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 11169913) has the molecular formula C47H72O3 and a molecular weight of 685.09 g/mol. Its IUPAC name is [2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | [2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 11169913 |
| Molecular Formula | C47H72O3 |
| Molecular Weight | 685.09 g/mol |
| Exact Mass | 684.55 |
| IUPAC Name | [2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Oc2cc(C)c3c(c2)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O3)C(C)(C)CCC1 |
| InChI | InChI=1S/C47H72O3/c1-34(2)17-12-18-35(3)19-13-20-36(4)23-15-29-47(11)30-27-41-33-42(32-40(8)45(41)50-47)49-44(48)31-38(6)22-14-21-37(5)25-26-43-39(7)24-16-28-46(43,9)10/h14,21-22,25-26,31-36H,12-13,15-20,23-24,27-30H2,1-11H3/b22-14+,26-25+,37-21+,38-31+ |
| InChIKey | ZOUSMOLZQVSXSV-RGLBSDOQSA-N |
| XLogP | 13.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.09 |
| LogP ≤ 5 | 13.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|