C38H52O2 — CID 166478804
[4-[(1E)-3,7-dimethylocta-1,6-dienyl]phenyl] (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;ethene (PubChem CID 166478804) has the molecular formula C38H52O2 and a molecular weight of 540.83 g/mol. Its IUPAC name is [4-[(1E)-3,7-dimethylocta-1,6-dienyl]phenyl] (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;ethene.
| Compound Name | [4-[(1E)-3,7-dimethylocta-1,6-dienyl]phenyl] (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;ethene |
|---|---|
| PubChem CID | 166478804 |
| Molecular Formula | C38H52O2 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.40 |
| IUPAC Name | [4-[(1E)-3,7-dimethylocta-1,6-dienyl]phenyl] (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;ethene |
| SMILES | C=C.CC(C)=CCCC(C)/C=C/c1ccc(OC(=O)/C=C(C)/C=C/C=C(C)\C=C\C2=C(C)CCCC2(C)C)cc1 |
| InChI | InChI=1S/C36H48O2.C2H4/c1-27(2)12-9-13-28(3)17-19-32-20-22-33(23-21-32)38-35(37)26-30(5)15-10-14-29(4)18-24-34-31(6)16-11-25-36(34,7)8;1-2/h10,12,14-15,17-24,26,28H,9,11,13,16,25H2,1-8H3;1-2H2/b15-10+,19-17+,24-18+,29-14-,30-26+; |
| InChIKey | YKTKCNGGCRPQPL-BDWMRDQJSA-N |
| XLogP | 11.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|