C28H33NO7 — CID 87462096
(4-nitrophenoxy)carbonyloxymethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 87462096) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is (4-nitrophenoxy)carbonyloxymethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | (4-nitrophenoxy)carbonyloxymethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 87462096 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (4-nitrophenoxy)carbonyloxymethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OCOC(=O)Oc2ccc([N+](=O)[O-])cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H33NO7/c1-20(11-16-25-22(3)10-7-17-28(25,4)5)8-6-9-21(2)18-26(30)34-19-35-27(31)36-24-14-12-23(13-15-24)29(32)33/h6,8-9,11-16,18H,7,10,17,19H2,1-5H3/b9-6+,16-11+,20-8+,21-18+ |
| InChIKey | RQYWRKUKCBPUCU-PPBWNBFDSA-N |
| XLogP | 7.14 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|