C42H60O2 — CID 157286285
(3E,5E,7Z,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-one (PubChem CID 157286285) has the molecular formula C42H60O2 and a molecular weight of 596.94 g/mol. Its IUPAC name is (3E,5E,7Z,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-one.
| Compound Name | (3E,5E,7Z,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-one |
|---|---|
| PubChem CID | 157286285 |
| Molecular Formula | C42H60O2 |
| Molecular Weight | 596.94 g/mol |
| Exact Mass | 596.46 |
| IUPAC Name | (3E,5E,7Z,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-one |
| SMILES | CC(=O)/C=C(C)/C=C/C=C(C)\C=C\C1=C(C)CCCC1(C)C.CC(=O)/C=C(C)/C=C/C=C(C)\C=C\C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/2C21H30O/c2*1-16(9-7-10-17(2)15-19(4)22)12-13-20-18(3)11-8-14-21(20,5)6/h2*7,9-10,12-13,15H,8,11,14H2,1-6H3/b2*10-7+,13-12+,16-9-,17-15+ |
| InChIKey | BAGRFEOSVOVJML-GSQRCXHPSA-N |
| XLogP | 12.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.94 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|