C22H32O2 — CID 21018382
(4E,6E,8E,10E)-1-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraen-3-one (PubChem CID 21018382) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (4E,6E,8E,10E)-1-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraen-3-one.
| Compound Name | (4E,6E,8E,10E)-1-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraen-3-one |
|---|---|
| PubChem CID | 21018382 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (4E,6E,8E,10E)-1-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraen-3-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)CCO)C(C)(C)CCC1 |
| InChI | InChI=1S/C22H32O2/c1-17(8-6-9-18(2)16-20(24)13-15-23)11-12-21-19(3)10-7-14-22(21,4)5/h6,8-9,11-12,16,23H,7,10,13-15H2,1-5H3/b9-6+,12-11+,17-8+,18-16+ |
| InChIKey | QHGAKWXZUFVFND-LYKFAKFTSA-N |
| XLogP | 5.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|