C26H41NO2 — CID 87392953
2-(diethylamino)ethyl (6Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 87392953) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is 2-(diethylamino)ethyl (6Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | 2-(diethylamino)ethyl (6Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 87392953 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | 2-(diethylamino)ethyl (6Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CCN(CC)CCOC(=O)C=C(C)C=C/C=C(/C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C26H41NO2/c1-8-27(9-2)18-19-29-25(28)20-22(4)13-10-12-21(3)15-16-24-23(5)14-11-17-26(24,6)7/h10,12-13,15-16,20H,8-9,11,14,17-19H2,1-7H3/b13-10?,16-15?,21-12-,22-20? |
| InChIKey | UHWQDBBVRCZUBM-MFYLDPNPSA-N |
| XLogP | 6.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|