C32H49NO9 — CID 44628956
2-(diethylamino)ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 44628956) has the molecular formula C32H49NO9 and a molecular weight of 591.74 g/mol. Its IUPAC name is 2-(diethylamino)ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-(diethylamino)ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 44628956 |
| Molecular Formula | C32H49NO9 |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.34 |
| IUPAC Name | 2-(diethylamino)ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCN(CC)CCOC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H41NO2.C6H8O7/c1-8-27(9-2)18-19-29-25(28)20-22(4)13-10-12-21(3)15-16-24-23(5)14-11-17-26(24,6)7;7-3(8)1-6(13,5(11)12)2-4(9)10/h10,12-13,15-16,20H,8-9,11,14,17-19H2,1-7H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b13-10+,16-15+,21-12+,22-20+; |
| InChIKey | FRPMXHSLJNWASW-XMHCNNHZSA-N |
| XLogP | 5.15 |
| TPSA | 161.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|