C30H45NO9 — CID 44628962
[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-(dimethylamino)acetate;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 44628962) has the molecular formula C30H45NO9 and a molecular weight of 563.69 g/mol. Its IUPAC name is [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-(dimethylamino)acetate;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-(dimethylamino)acetate;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 44628962 |
| Molecular Formula | C30H45NO9 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-(dimethylamino)acetate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/COC(=O)CN(C)C)C(C)(C)CCC1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H37NO2.C6H8O7/c1-19(13-14-22-21(3)12-9-16-24(22,4)5)10-8-11-20(2)15-17-27-23(26)18-25(6)7;7-3(8)1-6(13,5(11)12)2-4(9)10/h8,10-11,13-15H,9,12,16-18H2,1-7H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b11-8+,14-13+,19-10+,20-15+; |
| InChIKey | LNNSIWDVHRGWDF-YHCQPEIKSA-N |
| XLogP | 4.37 |
| TPSA | 161.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|