C24H34O6 — CID 54518127
4-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 54518127) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is 4-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2,3-dihydroxy-4-oxobutanoic acid.
| Compound Name | 4-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54518127 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 4-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CCOC(=O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C24H34O6/c1-16(11-12-19-18(3)10-7-14-24(19,4)5)8-6-9-17(2)13-15-30-23(29)21(26)20(25)22(27)28/h6,8-9,11-13,20-21,25-26H,7,10,14-15H2,1-5H3,(H,27,28) |
| InChIKey | YNVORJYXEFPUQZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|