C46H65NO5 — CID 22182702
bis[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-acetamidobutanedioate (PubChem CID 22182702) has the molecular formula C46H65NO5 and a molecular weight of 712.03 g/mol. Its IUPAC name is bis[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-acetamidobutanedioate.
| Compound Name | bis[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-acetamidobutanedioate |
|---|---|
| PubChem CID | 22182702 |
| Molecular Formula | C46H65NO5 |
| Molecular Weight | 712.03 g/mol |
| Exact Mass | 711.49 |
| IUPAC Name | bis[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-acetamidobutanedioate |
| SMILES | CC(=O)NC(CC(=O)OC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)C(=O)OC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C46H65NO5/c1-33(22-24-40-37(5)20-14-28-45(40,8)9)16-12-18-35(3)26-30-51-43(49)32-42(47-39(7)48)44(50)52-31-27-36(4)19-13-17-34(2)23-25-41-38(6)21-15-29-46(41,10)11/h12-13,16-19,22-27,42H,14-15,20-21,28-32H2,1-11H3,(H,47,48)/b18-12+,19-13+,24-22+,25-23+,33-16+,34-17+,35-26+,36-27+ |
| InChIKey | YLXFCVJBURYHMT-ONSMXHEISA-N |
| XLogP | 11.03 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.03 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|