C35H46N2O6 — CID 78122705
[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 3-formamido-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoate (PubChem CID 78122705) has the molecular formula C35H46N2O6 and a molecular weight of 590.76 g/mol. Its IUPAC name is [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 3-formamido-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoate.
| Compound Name | [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 3-formamido-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 78122705 |
| Molecular Formula | C35H46N2O6 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 3-formamido-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)C(CC(=O)OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C)NC=O |
| InChI | InChI=1S/C35H46N2O6/c1-25(17-18-29-27(3)14-11-20-35(29,4)5)12-10-13-26(2)19-21-43-32(39)23-30(36-24-38)33(40)37-31(34(41)42-6)22-28-15-8-7-9-16-28/h7-10,12-13,15-19,24,30-31H,11,14,20-23H2,1-6H3,(H,36,38)(H,37,40) |
| InChIKey | LSEQFCNTMKUQCA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|