C26H37NaO4 — CID 102244750
sodium 6-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-6-oxohexanoate (PubChem CID 102244750) has the molecular formula C26H37NaO4 and a molecular weight of 436.57 g/mol. Its IUPAC name is sodium 6-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-6-oxohexanoate.
| Compound Name | sodium 6-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-6-oxohexanoate |
|---|---|
| PubChem CID | 102244750 |
| Molecular Formula | C26H37NaO4 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | sodium 6-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-6-oxohexanoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/COC(=O)CCCCC(=O)[O-])C(C)(C)CCC1.[Na+] |
| InChI | InChI=1S/C26H38O4.Na/c1-20(15-16-23-22(3)12-9-18-26(23,4)5)10-8-11-21(2)17-19-30-25(29)14-7-6-13-24(27)28;/h8,10-11,15-17H,6-7,9,12-14,18-19H2,1-5H3,(H,27,28);/q;+1/p-1/b11-8+,16-15+,20-10+,21-17+; |
| InChIKey | IFDVAKRUVKBEHL-ZTHWYCKKSA-M |
| XLogP | 2.38 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|