C32H50O9 — CID 102244748
1-O-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 6-O-(2,3,4,5,6-pentahydroxyhexyl) hexanedioate (PubChem CID 102244748) has the molecular formula C32H50O9 and a molecular weight of 578.74 g/mol. Its IUPAC name is 1-O-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 6-O-(2,3,4,5,6-pentahydroxyhexyl) hexanedioate.
| Compound Name | 1-O-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 6-O-(2,3,4,5,6-pentahydroxyhexyl) hexanedioate |
|---|---|
| PubChem CID | 102244748 |
| Molecular Formula | C32H50O9 |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | 1-O-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 6-O-(2,3,4,5,6-pentahydroxyhexyl) hexanedioate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/COC(=O)CCCCC(=O)OCC(O)C(O)C(O)C(O)CO)C(C)(C)CCC1 |
| InChI | InChI=1S/C32H50O9/c1-22(15-16-25-24(3)12-9-18-32(25,4)5)10-8-11-23(2)17-19-40-28(36)13-6-7-14-29(37)41-21-27(35)31(39)30(38)26(34)20-33/h8,10-11,15-17,26-27,30-31,33-35,38-39H,6-7,9,12-14,18-21H2,1-5H3/b11-8+,16-15+,22-10+,23-17+ |
| InChIKey | JBGHHURWKXOWAO-DEARIWCASA-N |
| XLogP | 3.60 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|