C24H34O4 — CID 23288992
4-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-4-oxobutanoic acid (PubChem CID 23288992) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 4-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-4-oxobutanoic acid.
| Compound Name | 4-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 23288992 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 4-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-4-oxobutanoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/COC(=O)CCC(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C24H34O4/c1-18(11-12-21-20(3)10-7-16-24(21,4)5)8-6-9-19(2)15-17-28-23(27)14-13-22(25)26/h6,8-9,11-12,15H,7,10,13-14,16-17H2,1-5H3,(H,25,26)/b9-6+,12-11+,18-8+,19-15+ |
| InChIKey | KACRLIUJZICDCF-BGOSPGJOSA-N |
| XLogP | 5.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|